C19H18N4O8 — CID 169178183
1-(2,4-dinitrophenyl)-4-phenylmethoxycarbonylpiperazine-2-carboxylic acid (PubChem CID 169178183) has the molecular formula C19H18N4O8 and a molecular weight of 430.37 g/mol. Its IUPAC name is 1-(2,4-dinitrophenyl)-4-phenylmethoxycarbonylpiperazine-2-carboxylic acid.
| Compound Name | 1-(2,4-dinitrophenyl)-4-phenylmethoxycarbonylpiperazine-2-carboxylic acid |
|---|---|
| PubChem CID | 169178183 |
| Molecular Formula | C19H18N4O8 |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 1-(2,4-dinitrophenyl)-4-phenylmethoxycarbonylpiperazine-2-carboxylic acid |
| SMILES | O=C(O)C1CN(C(=O)OCc2ccccc2)CCN1c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H18N4O8/c24-18(25)17-11-20(19(26)31-12-13-4-2-1-3-5-13)8-9-21(17)15-7-6-14(22(27)28)10-16(15)23(29)30/h1-7,10,17H,8-9,11-12H2,(H,24,25) |
| InChIKey | RQOGSEFZDXKTIV-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 156.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|