C26H33FN4O4 — CID 178082041
benzyl 4-[2-[4-(2-fluoro-4-nitrophenyl)piperazin-1-yl]propan-2-yl]piperidine-1-carboxylate (PubChem CID 178082041) has the molecular formula C26H33FN4O4 and a molecular weight of 484.57 g/mol. Its IUPAC name is benzyl 4-[2-[4-(2-fluoro-4-nitrophenyl)piperazin-1-yl]propan-2-yl]piperidine-1-carboxylate.
| Compound Name | benzyl 4-[2-[4-(2-fluoro-4-nitrophenyl)piperazin-1-yl]propan-2-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 178082041 |
| Molecular Formula | C26H33FN4O4 |
| Molecular Weight | 484.57 g/mol |
| Exact Mass | 484.25 |
| IUPAC Name | benzyl 4-[2-[4-(2-fluoro-4-nitrophenyl)piperazin-1-yl]propan-2-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C1CCN(C(=O)OCc2ccccc2)CC1)N1CCN(c2ccc([N+](=O)[O-])cc2F)CC1 |
| InChI | InChI=1S/C26H33FN4O4/c1-26(2,21-10-12-29(13-11-21)25(32)35-19-20-6-4-3-5-7-20)30-16-14-28(15-17-30)24-9-8-22(31(33)34)18-23(24)27/h3-9,18,21H,10-17,19H2,1-2H3 |
| InChIKey | QZGDBMSNERSVAY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 79.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|