C18H27FN4O4 — CID 174174377
tert-butyl-[3-[4-(2-fluoro-4-nitrophenyl)piperazin-1-yl]propyl]carbamic acid (PubChem CID 174174377) has the molecular formula C18H27FN4O4 and a molecular weight of 382.44 g/mol. Its IUPAC name is tert-butyl-[3-[4-(2-fluoro-4-nitrophenyl)piperazin-1-yl]propyl]carbamic acid.
| Compound Name | tert-butyl-[3-[4-(2-fluoro-4-nitrophenyl)piperazin-1-yl]propyl]carbamic acid |
|---|---|
| PubChem CID | 174174377 |
| Molecular Formula | C18H27FN4O4 |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | tert-butyl-[3-[4-(2-fluoro-4-nitrophenyl)piperazin-1-yl]propyl]carbamic acid |
| SMILES | CC(C)(C)N(CCCN1CCN(c2ccc([N+](=O)[O-])cc2F)CC1)C(=O)O |
| InChI | InChI=1S/C18H27FN4O4/c1-18(2,3)22(17(24)25)8-4-7-20-9-11-21(12-10-20)16-6-5-14(23(26)27)13-15(16)19/h5-6,13H,4,7-12H2,1-3H3,(H,24,25) |
| InChIKey | BEFIOIWAAJMXLT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 90.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|