C14H19FN2O4 — CID 164897625
3-[1-(2-fluoro-4-nitrophenyl)piperidin-4-yl]propane-1,1-diol (PubChem CID 164897625) has the molecular formula C14H19FN2O4 and a molecular weight of 298.31 g/mol. Its IUPAC name is 3-[1-(2-fluoro-4-nitrophenyl)piperidin-4-yl]propane-1,1-diol.
| Compound Name | 3-[1-(2-fluoro-4-nitrophenyl)piperidin-4-yl]propane-1,1-diol |
|---|---|
| PubChem CID | 164897625 |
| Molecular Formula | C14H19FN2O4 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 3-[1-(2-fluoro-4-nitrophenyl)piperidin-4-yl]propane-1,1-diol |
| SMILES | O=[N+]([O-])c1ccc(N2CCC(CCC(O)O)CC2)c(F)c1 |
| InChI | InChI=1S/C14H19FN2O4/c15-12-9-11(17(20)21)2-3-13(12)16-7-5-10(6-8-16)1-4-14(18)19/h2-3,9-10,14,18-19H,1,4-8H2 |
| InChIKey | NIOOSRHXJXYUNK-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 86.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|