C15H20FN3O4S — CID 133487540
4-[1-(2-fluoro-4-nitrophenyl)piperidin-4-yl]-1,4-thiazinane 1,1-dioxide (PubChem CID 133487540) has the molecular formula C15H20FN3O4S and a molecular weight of 357.41 g/mol. Its IUPAC name is 4-[1-(2-fluoro-4-nitrophenyl)piperidin-4-yl]-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-[1-(2-fluoro-4-nitrophenyl)piperidin-4-yl]-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 133487540 |
| Molecular Formula | C15H20FN3O4S |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 4-[1-(2-fluoro-4-nitrophenyl)piperidin-4-yl]-1,4-thiazinane 1,1-dioxide |
| SMILES | O=[N+]([O-])c1ccc(N2CCC(N3CCS(=O)(=O)CC3)CC2)c(F)c1 |
| InChI | InChI=1S/C15H20FN3O4S/c16-14-11-13(19(20)21)1-2-15(14)18-5-3-12(4-6-18)17-7-9-24(22,23)10-8-17/h1-2,11-12H,3-10H2 |
| InChIKey | ZJFJJTAUENBKIC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 83.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|