C24H29FN4O4 — CID 172590969
benzyl N-[1-[1-(2-fluoro-4-nitrophenyl)piperidin-4-yl]piperidin-4-yl]carbamate (PubChem CID 172590969) has the molecular formula C24H29FN4O4 and a molecular weight of 456.52 g/mol. Its IUPAC name is benzyl N-[1-[1-(2-fluoro-4-nitrophenyl)piperidin-4-yl]piperidin-4-yl]carbamate.
| Compound Name | benzyl N-[1-[1-(2-fluoro-4-nitrophenyl)piperidin-4-yl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 172590969 |
| Molecular Formula | C24H29FN4O4 |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | benzyl N-[1-[1-(2-fluoro-4-nitrophenyl)piperidin-4-yl]piperidin-4-yl]carbamate |
| SMILES | O=C(NC1CCN(C2CCN(c3ccc([N+](=O)[O-])cc3F)CC2)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C24H29FN4O4/c25-22-16-21(29(31)32)6-7-23(22)28-14-10-20(11-15-28)27-12-8-19(9-13-27)26-24(30)33-17-18-4-2-1-3-5-18/h1-7,16,19-20H,8-15,17H2,(H,26,30) |
| InChIKey | QKJWUENVNPTEEP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 87.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|