C10H9FN2O2 — CID 57310080
1-(2-fluoro-4-nitrophenyl)-2,5-dihydropyrrole (PubChem CID 57310080) has the molecular formula C10H9FN2O2 and a molecular weight of 208.19 g/mol. Its IUPAC name is 1-(2-fluoro-4-nitrophenyl)-2,5-dihydropyrrole.
| Compound Name | 1-(2-fluoro-4-nitrophenyl)-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 57310080 |
| Molecular Formula | C10H9FN2O2 |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 1-(2-fluoro-4-nitrophenyl)-2,5-dihydropyrrole |
| SMILES | O=[N+]([O-])c1ccc(N2CC=CC2)c(F)c1 |
| InChI | InChI=1S/C10H9FN2O2/c11-9-7-8(13(14)15)3-4-10(9)12-5-1-2-6-12/h1-4,7H,5-6H2 |
| InChIKey | UJCXCYWCPXRYEP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|