C11H11FN2O2 — CID 141075149
1-(2-fluoro-4-nitrophenyl)-3,4-dihydro-2H-pyridine (PubChem CID 141075149) has the molecular formula C11H11FN2O2 and a molecular weight of 222.22 g/mol. Its IUPAC name is 1-(2-fluoro-4-nitrophenyl)-3,4-dihydro-2H-pyridine.
| Compound Name | 1-(2-fluoro-4-nitrophenyl)-3,4-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 141075149 |
| Molecular Formula | C11H11FN2O2 |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 1-(2-fluoro-4-nitrophenyl)-3,4-dihydro-2H-pyridine |
| SMILES | O=[N+]([O-])c1ccc(N2C=CCCC2)c(F)c1 |
| InChI | InChI=1S/C11H11FN2O2/c12-10-8-9(14(15)16)4-5-11(10)13-6-2-1-3-7-13/h2,4-6,8H,1,3,7H2 |
| InChIKey | KQMKKMDIEBBDOJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|