C10H10N2O2 — CID 67551933
1-(4-nitrophenyl)-2,3-dihydropyrrole (PubChem CID 67551933) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-2,3-dihydropyrrole.
| Compound Name | 1-(4-nitrophenyl)-2,3-dihydropyrrole |
|---|---|
| PubChem CID | 67551933 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 1-(4-nitrophenyl)-2,3-dihydropyrrole |
| SMILES | O=[N+]([O-])c1ccc(N2C=CCC2)cc1 |
| InChI | InChI=1S/C10H10N2O2/c13-12(14)10-5-3-9(4-6-10)11-7-1-2-8-11/h1,3-7H,2,8H2 |
| InChIKey | ADHYHUKFZGDYIS-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|