C10H9N2O3- — CID 172819719
1-(4-nitrophenyl)-2,3-dihydropyrrol-4-olate (PubChem CID 172819719) has the molecular formula C10H9N2O3- and a molecular weight of 205.19 g/mol. Its IUPAC name is 1-(4-nitrophenyl)-2,3-dihydropyrrol-4-olate.
| Compound Name | 1-(4-nitrophenyl)-2,3-dihydropyrrol-4-olate |
|---|---|
| PubChem CID | 172819719 |
| Molecular Formula | C10H9N2O3- |
| Molecular Weight | 205.19 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 1-(4-nitrophenyl)-2,3-dihydropyrrol-4-olate |
| SMILES | O=[N+]([O-])c1ccc(N2C=C([O-])CC2)cc1 |
| InChI | InChI=1S/C10H10N2O3/c13-10-5-6-11(7-10)8-1-3-9(4-2-8)12(14)15/h1-4,7,13H,5-6H2/p-1 |
| InChIKey | OAGBJIZCGCMWHF-UHFFFAOYSA-M |
| XLogP | 1.01 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.19 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|