C12H17N2O3P — CID 58071323
4-ethyl-1-(4-nitrophenyl)-1,4λ5-azaphosphinane 4-oxide (PubChem CID 58071323) has the molecular formula C12H17N2O3P and a molecular weight of 268.25 g/mol. Its IUPAC name is 4-ethyl-1-(4-nitrophenyl)-1,4λ5-azaphosphinane 4-oxide.
| Compound Name | 4-ethyl-1-(4-nitrophenyl)-1,4λ5-azaphosphinane 4-oxide |
|---|---|
| PubChem CID | 58071323 |
| Molecular Formula | C12H17N2O3P |
| Molecular Weight | 268.25 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 4-ethyl-1-(4-nitrophenyl)-1,4λ5-azaphosphinane 4-oxide |
| SMILES | CCP1(=O)CCN(c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C12H17N2O3P/c1-2-18(17)9-7-13(8-10-18)11-3-5-12(6-4-11)14(15)16/h3-6H,2,7-10H2,1H3 |
| InChIKey | MXNDPAMSUWRNPB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.25 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|