About 3-fluoro-4-morpholin-4-ylaniline;4-(2-fluoro-4-nitrophenyl)morpholine
3-fluoro-4-morpholin-4-ylaniline;4-(2-fluoro-4-nitrophenyl)morpholine (PubChem CID 69365394) has the molecular formula C20H24F2N4O4
and a molecular weight of 422.43 g/mol. Its IUPAC name is 3-fluoro-4-morpholin-4-ylaniline;4-(2-fluoro-4-nitrophenyl)morpholine.
Molecular Properties
| Compound Name | 3-fluoro-4-morpholin-4-ylaniline;4-(2-fluoro-4-nitrophenyl)morpholine |
| PubChem CID | 69365394 |
| Molecular Formula | C20H24F2N4O4 |
| Molecular Weight | 422.43 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | 3-fluoro-4-morpholin-4-ylaniline;4-(2-fluoro-4-nitrophenyl)morpholine |
| SMILES | Nc1ccc(N2CCOCC2)c(F)c1.O=[N+]([O-])c1ccc(N2CCOCC2)c(F)c1 |
| InChI | InChI=1S/C10H11FN2O3.C10H13FN2O/c11-9-7-8(13(14)15)1-2-10(9)12-3-5-16-6-4-12;11-9-7-8(12)1-2-10(9)13-3-5-14-6-4-13/h1-2,7H,3-6H2;1-2,7H,3-6,12H2 |
| InChIKey | JPQSTAOQMNTCRL-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 94.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.43 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-4-morpholin-4-ylaniline;4-(2-fluoro-4-nitrophenyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4-morpholin-4-ylaniline;4-(2-fluoro-4-nitrophenyl)morpholine?
The IUPAC name of 3-fluoro-4-morpholin-4-ylaniline;4-(2-fluoro-4-nitrophenyl)morpholine (CID 69365394) is 3-fluoro-4-morpholin-4-ylaniline;4-(2-fluoro-4-nitrophenyl)morpholine.
What is the SMILES notation for 3-fluoro-4-morpholin-4-ylaniline;4-(2-fluoro-4-nitrophenyl)morpholine?
The canonical SMILES for 3-fluoro-4-morpholin-4-ylaniline;4-(2-fluoro-4-nitrophenyl)morpholine is Nc1ccc(N2CCOCC2)c(F)c1.O=[N+]([O-])c1ccc(N2CCOCC2)c(F)c1.
What is the InChIKey of 3-fluoro-4-morpholin-4-ylaniline;4-(2-fluoro-4-nitrophenyl)morpholine?
The InChIKey is JPQSTAOQMNTCRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FN2O3.C10H13FN2O/c11-9-7-8(13(14)15)1-2-10(9)12-3-5-16-6-4-12;11-9-7-8(12)1-2-10(9)13-3-5-14-6-4-13/h1-2,7H,3-6H2;1-2,7H,3-6,12H2.
What are the key properties of 3-fluoro-4-morpholin-4-ylaniline;4-(2-fluoro-4-nitrophenyl)morpholine?
3-fluoro-4-morpholin-4-ylaniline;4-(2-fluoro-4-nitrophenyl)morpholine has a molecular weight of 422.43 g/mol, XLogP of 2.82, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-morpholin-4-ylaniline;4-(2-fluoro-4-nitrophenyl)morpholine is sourced from PubChem (CID 69365394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).