About 3-morpholin-4-ylaniline;4-(3-nitrophenyl)morpholine
3-morpholin-4-ylaniline;4-(3-nitrophenyl)morpholine (PubChem CID 159730458) has the molecular formula C20H26N4O4
and a molecular weight of 386.45 g/mol. Its IUPAC name is 3-morpholin-4-ylaniline;4-(3-nitrophenyl)morpholine.
Molecular Properties
| Compound Name | 3-morpholin-4-ylaniline;4-(3-nitrophenyl)morpholine |
| PubChem CID | 159730458 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 3-morpholin-4-ylaniline;4-(3-nitrophenyl)morpholine |
| SMILES | Nc1cccc(N2CCOCC2)c1.O=[N+]([O-])c1cccc(N2CCOCC2)c1 |
| InChI | InChI=1S/C10H12N2O3.C10H14N2O/c13-12(14)10-3-1-2-9(8-10)11-4-6-15-7-5-11;11-9-2-1-3-10(8-9)12-4-6-13-7-5-12/h1-3,8H,4-7H2;1-3,8H,4-7,11H2 |
| InChIKey | NBECOBVIYMFVIH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 94.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-morpholin-4-ylaniline;4-(3-nitrophenyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-morpholin-4-ylaniline;4-(3-nitrophenyl)morpholine?
The IUPAC name of 3-morpholin-4-ylaniline;4-(3-nitrophenyl)morpholine (CID 159730458) is 3-morpholin-4-ylaniline;4-(3-nitrophenyl)morpholine.
What is the SMILES notation for 3-morpholin-4-ylaniline;4-(3-nitrophenyl)morpholine?
The canonical SMILES for 3-morpholin-4-ylaniline;4-(3-nitrophenyl)morpholine is Nc1cccc(N2CCOCC2)c1.O=[N+]([O-])c1cccc(N2CCOCC2)c1.
What is the InChIKey of 3-morpholin-4-ylaniline;4-(3-nitrophenyl)morpholine?
The InChIKey is NBECOBVIYMFVIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O3.C10H14N2O/c13-12(14)10-3-1-2-9(8-10)11-4-6-15-7-5-11;11-9-2-1-3-10(8-9)12-4-6-13-7-5-12/h1-3,8H,4-7H2;1-3,8H,4-7,11H2.
What are the key properties of 3-morpholin-4-ylaniline;4-(3-nitrophenyl)morpholine?
3-morpholin-4-ylaniline;4-(3-nitrophenyl)morpholine has a molecular weight of 386.45 g/mol, XLogP of 2.54, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-morpholin-4-ylaniline;4-(3-nitrophenyl)morpholine is sourced from PubChem (CID 159730458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).