About 2-(3-nitrophenyl)-1,3-dihydroisoindole
2-(3-nitrophenyl)-1,3-dihydroisoindole (PubChem CID 698272) has the molecular formula C14H12N2O2
and a molecular weight of 240.26 g/mol. Its IUPAC name is 2-(3-nitrophenyl)-1,3-dihydroisoindole.
Molecular Properties
| Compound Name | 2-(3-nitrophenyl)-1,3-dihydroisoindole |
| PubChem CID | 698272 |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.09 |
| IUPAC Name | 2-(3-nitrophenyl)-1,3-dihydroisoindole |
| SMILES | O=[N+]([O-])c1cccc(N2Cc3ccccc3C2)c1 |
| InChI | InChI=1S/C14H12N2O2/c17-16(18)14-7-3-6-13(8-14)15-9-11-4-1-2-5-12(11)10-15/h1-8H,9-10H2 |
| InChIKey | KGTVGOAEWDYWLH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-nitrophenyl)-1,3-dihydroisoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-nitrophenyl)-1,3-dihydroisoindole?
The IUPAC name of 2-(3-nitrophenyl)-1,3-dihydroisoindole (CID 698272) is 2-(3-nitrophenyl)-1,3-dihydroisoindole.
What is the SMILES notation for 2-(3-nitrophenyl)-1,3-dihydroisoindole?
The canonical SMILES for 2-(3-nitrophenyl)-1,3-dihydroisoindole is O=[N+]([O-])c1cccc(N2Cc3ccccc3C2)c1.
What is the InChIKey of 2-(3-nitrophenyl)-1,3-dihydroisoindole?
The InChIKey is KGTVGOAEWDYWLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O2/c17-16(18)14-7-3-6-13(8-14)15-9-11-4-1-2-5-12(11)10-15/h1-8H,9-10H2.
What are the key properties of 2-(3-nitrophenyl)-1,3-dihydroisoindole?
2-(3-nitrophenyl)-1,3-dihydroisoindole has a molecular weight of 240.26 g/mol, XLogP of 3.12, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-nitrophenyl)-1,3-dihydroisoindole is sourced from PubChem (CID 698272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).