C15H14N2O2 — CID 14980700
2-(3-nitrophenyl)-3,4-dihydro-1H-isoquinoline (PubChem CID 14980700) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 2-(3-nitrophenyl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-(3-nitrophenyl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 14980700 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2-(3-nitrophenyl)-3,4-dihydro-1H-isoquinoline |
| SMILES | O=[N+]([O-])c1cccc(N2CCc3ccccc3C2)c1 |
| InChI | InChI=1S/C15H14N2O2/c18-17(19)15-7-3-6-14(10-15)16-9-8-12-4-1-2-5-13(12)11-16/h1-7,10H,8-9,11H2 |
| InChIKey | CTPKJNHUAGTOPH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|