C14H13N3O2 — CID 82120293
2-(4-nitro-2-pyridinyl)-3,4-dihydro-1H-isoquinoline (PubChem CID 82120293) has the molecular formula C14H13N3O2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 2-(4-nitro-2-pyridinyl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-(4-nitro-2-pyridinyl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 82120293 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 2-(4-nitro-2-pyridinyl)-3,4-dihydro-1H-isoquinoline |
| SMILES | O=[N+]([O-])c1ccnc(N2CCc3ccccc3C2)c1 |
| InChI | InChI=1S/C14H13N3O2/c18-17(19)13-5-7-15-14(9-13)16-8-6-11-3-1-2-4-12(11)10-16/h1-5,7,9H,6,8,10H2 |
| InChIKey | IMAIAUOFRIGTPB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|