C13H12N4O2 — CID 75378873
7-nitro-2-pyrimidin-2-yl-3,4-dihydro-1H-isoquinoline (PubChem CID 75378873) has the molecular formula C13H12N4O2 and a molecular weight of 256.26 g/mol. Its IUPAC name is 7-nitro-2-pyrimidin-2-yl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 7-nitro-2-pyrimidin-2-yl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 75378873 |
| Molecular Formula | C13H12N4O2 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 7-nitro-2-pyrimidin-2-yl-3,4-dihydro-1H-isoquinoline |
| SMILES | O=[N+]([O-])c1ccc2c(c1)CN(c1ncccn1)CC2 |
| InChI | InChI=1S/C13H12N4O2/c18-17(19)12-3-2-10-4-7-16(9-11(10)8-12)13-14-5-1-6-15-13/h1-3,5-6,8H,4,7,9H2 |
| InChIKey | PMEWEBPUVBNIQP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 72.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|