C20H16N6O2 — CID 133350243
7-nitro-2-(5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-3,4-dihydro-1H-isoquinoline (PubChem CID 133350243) has the molecular formula C20H16N6O2 and a molecular weight of 372.39 g/mol. Its IUPAC name is 7-nitro-2-(5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | 7-nitro-2-(5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 133350243 |
| Molecular Formula | C20H16N6O2 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 7-nitro-2-(5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-yl)-3,4-dihydro-1H-isoquinoline |
| SMILES | O=[N+]([O-])c1ccc2c(c1)CN(c1cc(-c3ccccc3)nc3ncnn13)CC2 |
| InChI | InChI=1S/C20H16N6O2/c27-26(28)17-7-6-14-8-9-24(12-16(14)10-17)19-11-18(15-4-2-1-3-5-15)23-20-21-13-22-25(19)20/h1-7,10-11,13H,8-9,12H2 |
| InChIKey | RRPDLLZUZVANGL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 89.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|