C14H13N7O2 — CID 171816523
6-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)-7H-purin-8-amine (PubChem CID 171816523) has the molecular formula C14H13N7O2 and a molecular weight of 311.31 g/mol. Its IUPAC name is 6-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)-7H-purin-8-amine.
| Compound Name | 6-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)-7H-purin-8-amine |
|---|---|
| PubChem CID | 171816523 |
| Molecular Formula | C14H13N7O2 |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 6-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)-7H-purin-8-amine |
| SMILES | Nc1nc2ncnc(N3CCc4ccc([N+](=O)[O-])cc4C3)c2[nH]1 |
| InChI | InChI=1S/C14H13N7O2/c15-14-18-11-12(19-14)16-7-17-13(11)20-4-3-8-1-2-10(21(22)23)5-9(8)6-20/h1-2,5,7H,3-4,6H2,(H3,15,16,17,18,19) |
| InChIKey | HMUXRGGXSDAKJA-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 126.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|