C16H13N3O2S — CID 133350159
7-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)thieno[3,2-b]pyridine (PubChem CID 133350159) has the molecular formula C16H13N3O2S and a molecular weight of 311.37 g/mol. Its IUPAC name is 7-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)thieno[3,2-b]pyridine.
| Compound Name | 7-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)thieno[3,2-b]pyridine |
|---|---|
| PubChem CID | 133350159 |
| Molecular Formula | C16H13N3O2S |
| Molecular Weight | 311.37 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 7-(7-nitro-3,4-dihydro-1H-isoquinolin-2-yl)thieno[3,2-b]pyridine |
| SMILES | O=[N+]([O-])c1ccc2c(c1)CN(c1ccnc3ccsc13)CC2 |
| InChI | InChI=1S/C16H13N3O2S/c20-19(21)13-2-1-11-4-7-18(10-12(11)9-13)15-3-6-17-14-5-8-22-16(14)15/h1-3,5-6,8-9H,4,7,10H2 |
| InChIKey | BIEKNJONFCFQDR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.37 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|