C13H13N3O4S2 — CID 26040101
2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-5-nitrobenzenesulfonamide (PubChem CID 26040101) has the molecular formula C13H13N3O4S2 and a molecular weight of 339.40 g/mol. Its IUPAC name is 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-5-nitrobenzenesulfonamide.
| Compound Name | 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-5-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 26040101 |
| Molecular Formula | C13H13N3O4S2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-5-nitrobenzenesulfonamide |
| SMILES | NS(=O)(=O)c1cc([N+](=O)[O-])ccc1N1CCc2sccc2C1 |
| InChI | InChI=1S/C13H13N3O4S2/c14-22(19,20)13-7-10(16(17)18)1-2-11(13)15-5-3-12-9(8-15)4-6-21-12/h1-2,4,6-7H,3,5,8H2,(H2,14,19,20) |
| InChIKey | XDZCXDWHIOLZQZ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|