C13H13ClN2S — CID 115468438
4-chloro-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)aniline (PubChem CID 115468438) has the molecular formula C13H13ClN2S and a molecular weight of 264.78 g/mol. Its IUPAC name is 4-chloro-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)aniline.
| Compound Name | 4-chloro-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)aniline |
|---|---|
| PubChem CID | 115468438 |
| Molecular Formula | C13H13ClN2S |
| Molecular Weight | 264.78 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 4-chloro-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)aniline |
| SMILES | Nc1ccc(Cl)cc1N1CCc2sccc2C1 |
| InChI | InChI=1S/C13H13ClN2S/c14-10-1-2-11(15)12(7-10)16-5-3-13-9(8-16)4-6-17-13/h1-2,4,6-7H,3,5,8,15H2 |
| InChIKey | YELMTVKQTFWTGA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.78 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|