C14H16N2S — CID 62588261
3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-methylaniline (PubChem CID 62588261) has the molecular formula C14H16N2S and a molecular weight of 244.36 g/mol. Its IUPAC name is 3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-methylaniline.
| Compound Name | 3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-methylaniline |
|---|---|
| PubChem CID | 62588261 |
| Molecular Formula | C14H16N2S |
| Molecular Weight | 244.36 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-4-methylaniline |
| SMILES | Cc1ccc(N)cc1N1CCc2sccc2C1 |
| InChI | InChI=1S/C14H16N2S/c1-10-2-3-12(15)8-13(10)16-6-4-14-11(9-16)5-7-17-14/h2-3,5,7-8H,4,6,9,15H2,1H3 |
| InChIKey | YJAVDUDOUCLVGT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|