C15H17N3S2 — CID 81060692
4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2,6-dimethylpyridine-3-carbothioamide (PubChem CID 81060692) has the molecular formula C15H17N3S2 and a molecular weight of 303.46 g/mol. Its IUPAC name is 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2,6-dimethylpyridine-3-carbothioamide.
| Compound Name | 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2,6-dimethylpyridine-3-carbothioamide |
|---|---|
| PubChem CID | 81060692 |
| Molecular Formula | C15H17N3S2 |
| Molecular Weight | 303.46 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-2,6-dimethylpyridine-3-carbothioamide |
| SMILES | Cc1cc(N2CCc3sccc3C2)c(C(N)=S)c(C)n1 |
| InChI | InChI=1S/C15H17N3S2/c1-9-7-12(14(15(16)19)10(2)17-9)18-5-3-13-11(8-18)4-6-20-13/h4,6-7H,3,5,8H2,1-2H3,(H2,16,19) |
| InChIKey | NMHGTXYBYLRHLN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|