C14H14FN3OS — CID 43658127
4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-fluoro-N'-hydroxybenzenecarboximidamide (PubChem CID 43658127) has the molecular formula C14H14FN3OS and a molecular weight of 291.35 g/mol. Its IUPAC name is 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-fluoro-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-fluoro-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 43658127 |
| Molecular Formula | C14H14FN3OS |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 4-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-fluoro-N'-hydroxybenzenecarboximidamide |
| SMILES | N/C(=N\O)c1ccc(N2CCc3sccc3C2)c(F)c1 |
| InChI | InChI=1S/C14H14FN3OS/c15-11-7-9(14(16)17-19)1-2-12(11)18-5-3-13-10(8-18)4-6-20-13/h1-2,4,6-7,19H,3,5,8H2,(H2,16,17) |
| InChIKey | MLQDQYDAVWXHNE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|