C13H18FN3OS — CID 77020685
4-(2,6-dimethylthiomorpholin-4-yl)-3-fluoro-N'-hydroxybenzenecarboximidamide (PubChem CID 77020685) has the molecular formula C13H18FN3OS and a molecular weight of 283.37 g/mol. Its IUPAC name is 4-(2,6-dimethylthiomorpholin-4-yl)-3-fluoro-N'-hydroxybenzenecarboximidamide.
| Compound Name | 4-(2,6-dimethylthiomorpholin-4-yl)-3-fluoro-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 77020685 |
| Molecular Formula | C13H18FN3OS |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 4-(2,6-dimethylthiomorpholin-4-yl)-3-fluoro-N'-hydroxybenzenecarboximidamide |
| SMILES | CC1CN(c2ccc(C(N)=NO)cc2F)CC(C)S1 |
| InChI | InChI=1S/C13H18FN3OS/c1-8-6-17(7-9(2)19-8)12-4-3-10(5-11(12)14)13(15)16-18/h3-5,8-9,18H,6-7H2,1-2H3,(H2,15,16) |
| InChIKey | MIARUYGPMLDMNK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|