C15H16N2O2S — CID 82790741
methyl 4-amino-3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzoate (PubChem CID 82790741) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is methyl 4-amino-3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzoate.
| Compound Name | methyl 4-amino-3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzoate |
|---|---|
| PubChem CID | 82790741 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | methyl 4-amino-3-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzoate |
| SMILES | COC(=O)c1ccc(N)c(N2CCc3sccc3C2)c1 |
| InChI | InChI=1S/C15H16N2O2S/c1-19-15(18)10-2-3-12(16)13(8-10)17-6-4-14-11(9-17)5-7-20-14/h2-3,5,7-8H,4,6,9,16H2,1H3 |
| InChIKey | LJRXQIFIPNOIEY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|