C14H13ClN2S2 — CID 63083216
4-chloro-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzenecarbothioamide (PubChem CID 63083216) has the molecular formula C14H13ClN2S2 and a molecular weight of 308.86 g/mol. Its IUPAC name is 4-chloro-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzenecarbothioamide.
| Compound Name | 4-chloro-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 63083216 |
| Molecular Formula | C14H13ClN2S2 |
| Molecular Weight | 308.86 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 4-chloro-2-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(Cl)cc1N1CCc2sccc2C1 |
| InChI | InChI=1S/C14H13ClN2S2/c15-10-1-2-11(14(16)18)12(7-10)17-5-3-13-9(8-17)4-6-19-13/h1-2,4,6-7H,3,5,8H2,(H2,16,18) |
| InChIKey | WRIGPJRLUMQMAD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.86 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|