C15H12ClFN2S — CID 103495654
4-chloro-2-(6-fluoro-2,3-dihydroindol-1-yl)benzenecarbothioamide (PubChem CID 103495654) has the molecular formula C15H12ClFN2S and a molecular weight of 306.79 g/mol. Its IUPAC name is 4-chloro-2-(6-fluoro-2,3-dihydroindol-1-yl)benzenecarbothioamide.
| Compound Name | 4-chloro-2-(6-fluoro-2,3-dihydroindol-1-yl)benzenecarbothioamide |
|---|---|
| PubChem CID | 103495654 |
| Molecular Formula | C15H12ClFN2S |
| Molecular Weight | 306.79 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 4-chloro-2-(6-fluoro-2,3-dihydroindol-1-yl)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(Cl)cc1N1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C15H12ClFN2S/c16-10-2-4-12(15(18)20)14(7-10)19-6-5-9-1-3-11(17)8-13(9)19/h1-4,7-8H,5-6H2,(H2,18,20) |
| InChIKey | XTWRGCOKWVXRNG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.79 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|