C14H12FN3S — CID 103495649
6-(6-fluoro-2,3-dihydroindol-1-yl)pyridine-3-carbothioamide (PubChem CID 103495649) has the molecular formula C14H12FN3S and a molecular weight of 273.34 g/mol. Its IUPAC name is 6-(6-fluoro-2,3-dihydroindol-1-yl)pyridine-3-carbothioamide.
| Compound Name | 6-(6-fluoro-2,3-dihydroindol-1-yl)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 103495649 |
| Molecular Formula | C14H12FN3S |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 6-(6-fluoro-2,3-dihydroindol-1-yl)pyridine-3-carbothioamide |
| SMILES | NC(=S)c1ccc(N2CCc3ccc(F)cc32)nc1 |
| InChI | InChI=1S/C14H12FN3S/c15-11-3-1-9-5-6-18(12(9)7-11)13-4-2-10(8-17-13)14(16)19/h1-4,7-8H,5-6H2,(H2,16,19) |
| InChIKey | SNURRUFVWMWLQS-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|