C17H20FN3 — CID 103499268
N-[[6-(6-fluoro-2,3-dihydroindol-1-yl)-3-pyridinyl]methyl]propan-1-amine (PubChem CID 103499268) has the molecular formula C17H20FN3 and a molecular weight of 285.37 g/mol. Its IUPAC name is N-[[6-(6-fluoro-2,3-dihydroindol-1-yl)-3-pyridinyl]methyl]propan-1-amine.
| Compound Name | N-[[6-(6-fluoro-2,3-dihydroindol-1-yl)-3-pyridinyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 103499268 |
| Molecular Formula | C17H20FN3 |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | N-[[6-(6-fluoro-2,3-dihydroindol-1-yl)-3-pyridinyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(N2CCc3ccc(F)cc32)nc1 |
| InChI | InChI=1S/C17H20FN3/c1-2-8-19-11-13-3-6-17(20-12-13)21-9-7-14-4-5-15(18)10-16(14)21/h3-6,10,12,19H,2,7-9,11H2,1H3 |
| InChIKey | MUIUPCUCCIRELZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|