C14H13FN2O — CID 103498498
[6-(6-fluoro-2,3-dihydroindol-1-yl)-3-pyridinyl]methanol (PubChem CID 103498498) has the molecular formula C14H13FN2O and a molecular weight of 244.27 g/mol. Its IUPAC name is [6-(6-fluoro-2,3-dihydroindol-1-yl)-3-pyridinyl]methanol.
| Compound Name | [6-(6-fluoro-2,3-dihydroindol-1-yl)-3-pyridinyl]methanol |
|---|---|
| PubChem CID | 103498498 |
| Molecular Formula | C14H13FN2O |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | [6-(6-fluoro-2,3-dihydroindol-1-yl)-3-pyridinyl]methanol |
| SMILES | OCc1ccc(N2CCc3ccc(F)cc32)nc1 |
| InChI | InChI=1S/C14H13FN2O/c15-12-3-2-11-5-6-17(13(11)7-12)14-4-1-10(9-18)8-16-14/h1-4,7-8,18H,5-6,9H2 |
| InChIKey | KWJBGSJQXCLHBF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |