C14H13BrN2 — CID 107079443
1-[5-(bromomethyl)-2-pyridinyl]-2,3-dihydroindole (PubChem CID 107079443) has the molecular formula C14H13BrN2 and a molecular weight of 289.18 g/mol. Its IUPAC name is 1-[5-(bromomethyl)-2-pyridinyl]-2,3-dihydroindole.
| Compound Name | 1-[5-(bromomethyl)-2-pyridinyl]-2,3-dihydroindole |
|---|---|
| PubChem CID | 107079443 |
| Molecular Formula | C14H13BrN2 |
| Molecular Weight | 289.18 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 1-[5-(bromomethyl)-2-pyridinyl]-2,3-dihydroindole |
| SMILES | BrCc1ccc(N2CCc3ccccc32)nc1 |
| InChI | InChI=1S/C14H13BrN2/c15-9-11-5-6-14(16-10-11)17-8-7-12-3-1-2-4-13(12)17/h1-6,10H,7-9H2 |
| InChIKey | RMOFFZCNDNNPNY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.18 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|