C14H14N4 — CID 24698172
6-(2,3-dihydroindol-1-yl)pyridine-3-carboximidamide (PubChem CID 24698172) has the molecular formula C14H14N4 and a molecular weight of 238.29 g/mol. Its IUPAC name is 6-(2,3-dihydroindol-1-yl)pyridine-3-carboximidamide.
| Compound Name | 6-(2,3-dihydroindol-1-yl)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 24698172 |
| Molecular Formula | C14H14N4 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 6-(2,3-dihydroindol-1-yl)pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N2CCc3ccccc32)nc1 |
| InChI | InChI=1S/C14H14N4/c15-14(16)11-5-6-13(17-9-11)18-8-7-10-3-1-2-4-12(10)18/h1-6,9H,7-8H2,(H3,15,16) |
| InChIKey | URGCIIAVIWEENP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|