C13H20N4 — CID 62937761
6-(4,4-dimethylpiperidin-1-yl)pyridine-3-carboximidamide (PubChem CID 62937761) has the molecular formula C13H20N4 and a molecular weight of 232.33 g/mol. Its IUPAC name is 6-(4,4-dimethylpiperidin-1-yl)pyridine-3-carboximidamide.
| Compound Name | 6-(4,4-dimethylpiperidin-1-yl)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 62937761 |
| Molecular Formula | C13H20N4 |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | 6-(4,4-dimethylpiperidin-1-yl)pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N2CCC(C)(C)CC2)nc1 |
| InChI | InChI=1S/C13H20N4/c1-13(2)5-7-17(8-6-13)11-4-3-10(9-16-11)12(14)15/h3-4,9H,5-8H2,1-2H3,(H3,14,15) |
| InChIKey | OSWFZIHZUVLULZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|