C17H21N5 — CID 24704018
6-(4-benzylpiperazin-1-yl)pyridine-3-carboximidamide (PubChem CID 24704018) has the molecular formula C17H21N5 and a molecular weight of 295.39 g/mol. Its IUPAC name is 6-(4-benzylpiperazin-1-yl)pyridine-3-carboximidamide.
| Compound Name | 6-(4-benzylpiperazin-1-yl)pyridine-3-carboximidamide |
|---|---|
| PubChem CID | 24704018 |
| Molecular Formula | C17H21N5 |
| Molecular Weight | 295.39 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 6-(4-benzylpiperazin-1-yl)pyridine-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(N2CCN(Cc3ccccc3)CC2)nc1 |
| InChI | InChI=1S/C17H21N5/c18-17(19)15-6-7-16(20-12-15)22-10-8-21(9-11-22)13-14-4-2-1-3-5-14/h1-7,12H,8-11,13H2,(H3,18,19) |
| InChIKey | IEPMFIJBCXYAJE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 69.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|