C13H11N4+ — CID 58798115
6-(2,3-dihydroindol-1-yl)pyridine-3-diazonium (PubChem CID 58798115) has the molecular formula C13H11N4+ and a molecular weight of 223.26 g/mol. Its IUPAC name is 6-(2,3-dihydroindol-1-yl)pyridine-3-diazonium.
| Compound Name | 6-(2,3-dihydroindol-1-yl)pyridine-3-diazonium |
|---|---|
| PubChem CID | 58798115 |
| Molecular Formula | C13H11N4+ |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 6-(2,3-dihydroindol-1-yl)pyridine-3-diazonium |
| SMILES | N#[N+]c1ccc(N2CCc3ccccc32)nc1 |
| InChI | InChI=1S/C13H11N4/c14-16-11-5-6-13(15-9-11)17-8-7-10-3-1-2-4-12(10)17/h1-6,9H,7-8H2/q+1 |
| InChIKey | NQSFBQBXRCEIAP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 44.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|