C15H18N4O2S — CID 113016627
1-[5-(dimethylsulfamoylamino)-2-pyridinyl]-2,3-dihydroindole (PubChem CID 113016627) has the molecular formula C15H18N4O2S and a molecular weight of 318.40 g/mol. Its IUPAC name is 1-[5-(dimethylsulfamoylamino)-2-pyridinyl]-2,3-dihydroindole.
| Compound Name | 1-[5-(dimethylsulfamoylamino)-2-pyridinyl]-2,3-dihydroindole |
|---|---|
| PubChem CID | 113016627 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 1-[5-(dimethylsulfamoylamino)-2-pyridinyl]-2,3-dihydroindole |
| SMILES | CN(C)S(=O)(=O)Nc1ccc(N2CCc3ccccc32)nc1 |
| InChI | InChI=1S/C15H18N4O2S/c1-18(2)22(20,21)17-13-7-8-15(16-11-13)19-10-9-12-5-3-4-6-14(12)19/h3-8,11,17H,9-10H2,1-2H3 |
| InChIKey | BRIWTYNLNSBALT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |