C19H26N4O2S — CID 113015482
2-(4-benzylpiperidin-1-yl)-5-(dimethylsulfamoylamino)pyridine (PubChem CID 113015482) has the molecular formula C19H26N4O2S and a molecular weight of 374.51 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-5-(dimethylsulfamoylamino)pyridine.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-5-(dimethylsulfamoylamino)pyridine |
|---|---|
| PubChem CID | 113015482 |
| Molecular Formula | C19H26N4O2S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-5-(dimethylsulfamoylamino)pyridine |
| SMILES | CN(C)S(=O)(=O)Nc1ccc(N2CCC(Cc3ccccc3)CC2)nc1 |
| InChI | InChI=1S/C19H26N4O2S/c1-22(2)26(24,25)21-18-8-9-19(20-15-18)23-12-10-17(11-13-23)14-16-6-4-3-5-7-16/h3-9,15,17,21H,10-14H2,1-2H3 |
| InChIKey | IXUDOWSTDWMREM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |