C14H16N4 — CID 82055128
[6-(3,4-dihydro-2H-quinolin-1-yl)-3-pyridinyl]hydrazine (PubChem CID 82055128) has the molecular formula C14H16N4 and a molecular weight of 240.31 g/mol. Its IUPAC name is [6-(3,4-dihydro-2H-quinolin-1-yl)-3-pyridinyl]hydrazine.
| Compound Name | [6-(3,4-dihydro-2H-quinolin-1-yl)-3-pyridinyl]hydrazine |
|---|---|
| PubChem CID | 82055128 |
| Molecular Formula | C14H16N4 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | [6-(3,4-dihydro-2H-quinolin-1-yl)-3-pyridinyl]hydrazine |
| SMILES | NNc1ccc(N2CCCc3ccccc32)nc1 |
| InChI | InChI=1S/C14H16N4/c15-17-12-7-8-14(16-10-12)18-9-3-5-11-4-1-2-6-13(11)18/h1-2,4,6-8,10,17H,3,5,9,15H2 |
| InChIKey | PUEHWAMFRYFZBB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|