C23H24N4S — CID 133149888
1-[6-(3,4-dihydro-2H-quinolin-1-yl)-3-pyridinyl]-3-(1-phenylethyl)thiourea (PubChem CID 133149888) has the molecular formula C23H24N4S and a molecular weight of 388.54 g/mol. Its IUPAC name is 1-[6-(3,4-dihydro-2H-quinolin-1-yl)-3-pyridinyl]-3-(1-phenylethyl)thiourea.
| Compound Name | 1-[6-(3,4-dihydro-2H-quinolin-1-yl)-3-pyridinyl]-3-(1-phenylethyl)thiourea |
|---|---|
| PubChem CID | 133149888 |
| Molecular Formula | C23H24N4S |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 1-[6-(3,4-dihydro-2H-quinolin-1-yl)-3-pyridinyl]-3-(1-phenylethyl)thiourea |
| SMILES | CC(NC(=S)Nc1ccc(N2CCCc3ccccc32)nc1)c1ccccc1 |
| InChI | InChI=1S/C23H24N4S/c1-17(18-8-3-2-4-9-18)25-23(28)26-20-13-14-22(24-16-20)27-15-7-11-19-10-5-6-12-21(19)27/h2-6,8-10,12-14,16-17H,7,11,15H2,1H3,(H2,25,26,28) |
| InChIKey | FTWLAIJMFQISPC-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|