C20H26N4S — CID 125045221
1-[6-[(3S)-3-methylpiperidin-1-yl]-3-pyridinyl]-3-[(1R)-1-phenylethyl]thiourea (PubChem CID 125045221) has the molecular formula C20H26N4S and a molecular weight of 354.52 g/mol. Its IUPAC name is 1-[6-[(3S)-3-methylpiperidin-1-yl]-3-pyridinyl]-3-[(1R)-1-phenylethyl]thiourea.
| Compound Name | 1-[6-[(3S)-3-methylpiperidin-1-yl]-3-pyridinyl]-3-[(1R)-1-phenylethyl]thiourea |
|---|---|
| PubChem CID | 125045221 |
| Molecular Formula | C20H26N4S |
| Molecular Weight | 354.52 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 1-[6-[(3S)-3-methylpiperidin-1-yl]-3-pyridinyl]-3-[(1R)-1-phenylethyl]thiourea |
| SMILES | C[C@H]1CCCN(c2ccc(NC(=S)N[C@H](C)c3ccccc3)cn2)C1 |
| InChI | InChI=1S/C20H26N4S/c1-15-7-6-12-24(14-15)19-11-10-18(13-21-19)23-20(25)22-16(2)17-8-4-3-5-9-17/h3-5,8-11,13,15-16H,6-7,12,14H2,1-2H3,(H2,22,23,25)/t15-,16+/m0/s1 |
| InChIKey | DVQZASQDGQOQFF-JKSUJKDBSA-N |
| XLogP | 4.37 |
| TPSA | 40.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|