C16H16N2 — CID 102545853
1-(5-ethenyl-4-methyl-2-pyridinyl)-2,3-dihydroindole (PubChem CID 102545853) has the molecular formula C16H16N2 and a molecular weight of 236.32 g/mol. Its IUPAC name is 1-(5-ethenyl-4-methyl-2-pyridinyl)-2,3-dihydroindole.
| Compound Name | 1-(5-ethenyl-4-methyl-2-pyridinyl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 102545853 |
| Molecular Formula | C16H16N2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 1-(5-ethenyl-4-methyl-2-pyridinyl)-2,3-dihydroindole |
| SMILES | C=Cc1cnc(N2CCc3ccccc32)cc1C |
| InChI | InChI=1S/C16H16N2/c1-3-13-11-17-16(10-12(13)2)18-9-8-14-6-4-5-7-15(14)18/h3-7,10-11H,1,8-9H2,2H3 |
| InChIKey | DIDCKGUVNRDVOH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |