C12H10FN3 — CID 115416366
1-(6-fluoropyrimidin-4-yl)-2,3-dihydroindole (PubChem CID 115416366) has the molecular formula C12H10FN3 and a molecular weight of 215.23 g/mol. Its IUPAC name is 1-(6-fluoropyrimidin-4-yl)-2,3-dihydroindole.
| Compound Name | 1-(6-fluoropyrimidin-4-yl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 115416366 |
| Molecular Formula | C12H10FN3 |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 1-(6-fluoropyrimidin-4-yl)-2,3-dihydroindole |
| SMILES | Fc1cc(N2CCc3ccccc32)ncn1 |
| InChI | InChI=1S/C12H10FN3/c13-11-7-12(15-8-14-11)16-6-5-9-3-1-2-4-10(9)16/h1-4,7-8H,5-6H2 |
| InChIKey | PDSOPOXXJBNVJT-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |