C15H13ClFNO — CID 103498387
[4-chloro-2-(6-fluoro-2,3-dihydroindol-1-yl)phenyl]methanol (PubChem CID 103498387) has the molecular formula C15H13ClFNO and a molecular weight of 277.73 g/mol. Its IUPAC name is [4-chloro-2-(6-fluoro-2,3-dihydroindol-1-yl)phenyl]methanol.
| Compound Name | [4-chloro-2-(6-fluoro-2,3-dihydroindol-1-yl)phenyl]methanol |
|---|---|
| PubChem CID | 103498387 |
| Molecular Formula | C15H13ClFNO |
| Molecular Weight | 277.73 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | [4-chloro-2-(6-fluoro-2,3-dihydroindol-1-yl)phenyl]methanol |
| SMILES | OCc1ccc(Cl)cc1N1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C15H13ClFNO/c16-12-3-1-11(9-19)14(7-12)18-6-5-10-2-4-13(17)8-15(10)18/h1-4,7-8,19H,5-6,9H2 |
| InChIKey | RKSPNTPSTZDIGN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.73 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |