C16H15F2NO — CID 103498394
1-[3-fluoro-4-(6-fluoro-2,3-dihydroindol-1-yl)phenyl]ethanol (PubChem CID 103498394) has the molecular formula C16H15F2NO and a molecular weight of 275.30 g/mol. Its IUPAC name is 1-[3-fluoro-4-(6-fluoro-2,3-dihydroindol-1-yl)phenyl]ethanol.
| Compound Name | 1-[3-fluoro-4-(6-fluoro-2,3-dihydroindol-1-yl)phenyl]ethanol |
|---|---|
| PubChem CID | 103498394 |
| Molecular Formula | C16H15F2NO |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 1-[3-fluoro-4-(6-fluoro-2,3-dihydroindol-1-yl)phenyl]ethanol |
| SMILES | CC(O)c1ccc(N2CCc3ccc(F)cc32)c(F)c1 |
| InChI | InChI=1S/C16H15F2NO/c1-10(20)12-3-5-15(14(18)8-12)19-7-6-11-2-4-13(17)9-16(11)19/h2-5,8-10,20H,6-7H2,1H3 |
| InChIKey | AQPTWWIASABETN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |