C16H17FN2 — CID 103496814
(1R)-1-[4-(6-fluoro-2,3-dihydroindol-1-yl)phenyl]ethanamine (PubChem CID 103496814) has the molecular formula C16H17FN2 and a molecular weight of 256.32 g/mol. Its IUPAC name is (1R)-1-[4-(6-fluoro-2,3-dihydroindol-1-yl)phenyl]ethanamine.
| Compound Name | (1R)-1-[4-(6-fluoro-2,3-dihydroindol-1-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 103496814 |
| Molecular Formula | C16H17FN2 |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | (1R)-1-[4-(6-fluoro-2,3-dihydroindol-1-yl)phenyl]ethanamine |
| SMILES | C[C@@H](N)c1ccc(N2CCc3ccc(F)cc32)cc1 |
| InChI | InChI=1S/C16H17FN2/c1-11(18)12-3-6-15(7-4-12)19-9-8-13-2-5-14(17)10-16(13)19/h2-7,10-11H,8-9,18H2,1H3/t11-/m1/s1 |
| InChIKey | XFDVJWVLPALYFF-LLVKDONJSA-N |
| XLogP | 3.54 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |