C16H17FN2O — CID 103496794
2-(1-aminoethyl)-5-(6-fluoro-2,3-dihydroindol-1-yl)phenol (PubChem CID 103496794) has the molecular formula C16H17FN2O and a molecular weight of 272.32 g/mol. Its IUPAC name is 2-(1-aminoethyl)-5-(6-fluoro-2,3-dihydroindol-1-yl)phenol.
| Compound Name | 2-(1-aminoethyl)-5-(6-fluoro-2,3-dihydroindol-1-yl)phenol |
|---|---|
| PubChem CID | 103496794 |
| Molecular Formula | C16H17FN2O |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 2-(1-aminoethyl)-5-(6-fluoro-2,3-dihydroindol-1-yl)phenol |
| SMILES | CC(N)c1ccc(N2CCc3ccc(F)cc32)cc1O |
| InChI | InChI=1S/C16H17FN2O/c1-10(18)14-5-4-13(9-16(14)20)19-7-6-11-2-3-12(17)8-15(11)19/h2-5,8-10,20H,6-7,18H2,1H3 |
| InChIKey | NNNFVNRXIBQRBV-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|