C15H12FNO — CID 122476442
1-(4-fluorophenyl)-2,3-dihydroindole-6-carbaldehyde (PubChem CID 122476442) has the molecular formula C15H12FNO and a molecular weight of 241.27 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2,3-dihydroindole-6-carbaldehyde.
| Compound Name | 1-(4-fluorophenyl)-2,3-dihydroindole-6-carbaldehyde |
|---|---|
| PubChem CID | 122476442 |
| Molecular Formula | C15H12FNO |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 1-(4-fluorophenyl)-2,3-dihydroindole-6-carbaldehyde |
| SMILES | O=Cc1ccc2c(c1)N(c1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C15H12FNO/c16-13-3-5-14(6-4-13)17-8-7-12-2-1-11(10-18)9-15(12)17/h1-6,9-10H,7-8H2 |
| InChIKey | YTTIWDBEYIDGCB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|