C14H11ClF2N2 — CID 103501441
1-[4-(chloromethyl)-3-fluoro-2-pyridinyl]-6-fluoro-2,3-dihydroindole (PubChem CID 103501441) has the molecular formula C14H11ClF2N2 and a molecular weight of 280.71 g/mol. Its IUPAC name is 1-[4-(chloromethyl)-3-fluoro-2-pyridinyl]-6-fluoro-2,3-dihydroindole.
| Compound Name | 1-[4-(chloromethyl)-3-fluoro-2-pyridinyl]-6-fluoro-2,3-dihydroindole |
|---|---|
| PubChem CID | 103501441 |
| Molecular Formula | C14H11ClF2N2 |
| Molecular Weight | 280.71 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | 1-[4-(chloromethyl)-3-fluoro-2-pyridinyl]-6-fluoro-2,3-dihydroindole |
| SMILES | Fc1ccc2c(c1)N(c1nccc(CCl)c1F)CC2 |
| InChI | InChI=1S/C14H11ClF2N2/c15-8-10-3-5-18-14(13(10)17)19-6-4-9-1-2-11(16)7-12(9)19/h1-3,5,7H,4,6,8H2 |
| InChIKey | FYRQUXPAANMVTM-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.71 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|